cas: 116170-84-4 — see every product listed under this CAS number, including other names
Ethyl 4-cyano-5-(methylthio)thiophene-2-carboxylate 98% (CAS 116170-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120860-100mg |
| cas | 116170-84-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1277.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120860 |
Ethyl 4-cyano-5-methylsulfanylthiophene-2-carboxylate (CAS 116170-84-4) is a chemical compound with the molecular formula C9H9NO2S2 and a molecular weight of 227.3 g/mol. IUPAC name: ethyl 4-cyano-5-methylsulfanylthiophene-2-carboxylate. InChIKey: UOHGLSFLWKHJKB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S2 |
|---|---|
| Molecular weight | 227.3 g/mol |
| IUPAC name | ethyl 4-cyano-5-methylsulfanylthiophene-2-carboxylate |
| InChIKey | UOHGLSFLWKHJKB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(S1)SC)C#N |
Computed by PubChem (NCBI)