CAS 588676-61-3 is the registry number for Methyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate (CAS 588676-61-3) is a chemical compound with the molecular formula C9H9NO2S2 and a molecular weight of 227.3 g/mol. IUPAC name: methyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate. InChIKey: YYQIQCGIUXTUIR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S2 |
|---|---|
| Molecular weight | 227.3 g/mol |
| IUPAC name | methyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate |
| InChIKey | YYQIQCGIUXTUIR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)N=C=S)C |
Computed by PubChem (NCBI)