cas: 300590-94-7 — see every product listed under this CAS number, including other names
Ethyl 4-hydroxy-2-methylquinoline-6-carboxylate 95% (CAS 300590-94-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311931-100mg |
| cas | 300590-94-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 4787.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A311931 |
Ethyl 2-methyl-4-oxo-1H-quinoline-6-carboxylate (CAS 300590-94-7) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 2-methyl-4-oxo-1H-quinoline-6-carboxylate. InChIKey: ZBJWZYUUWDUKMK-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 2-methyl-4-oxo-1H-quinoline-6-carboxylate |
| InChIKey | ZBJWZYUUWDUKMK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=CC2=O)C |
Computed by PubChem (NCBI)