Products 876294-76-7
CAS 876294-76-7 appears in our catalog under these names: 1-(4-Hydroxyphenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%, 1-(4-Hydroxyphenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-(4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 876294-76-7) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: ODBKIBCZAKZZCT-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | ODBKIBCZAKZZCT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)O)C)C(=O)O |
Computed by PubChem (NCBI)