cas: 1073338-92-7 — see every product listed under this CAS number, including other names
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate, 98%, 98% (CAS 1073338-92-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QBR-250mg |
| cas | 1073338-92-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 1350.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate (CAS 1073338-92-7) is a chemical compound with the molecular formula C13H19BO5 and a molecular weight of 266.10 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate. InChIKey: UMMKKZJPSPIDGN-UHFFFAOYSA-N.
| Molecular formula | C13H19BO5 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate |
| InChIKey | UMMKKZJPSPIDGN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)C(=O)OCC |
Computed by PubChem (NCBI)