CAS 1315339-43-5 appears in our catalog under these names: 2,2-Dimethylpropyl-4'-methoxybenzoate-2'-boronic acid, 95%, (5-Methoxy-2-((neopentyloxy)carbonyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[2-(2,2-dimethylpropoxycarbonyl)-5-methoxyphenyl]boronic acid (CAS 1315339-43-5) is a chemical compound with the molecular formula C13H19BO5 and a molecular weight of 266.10 g/mol. IUPAC name: [2-(2,2-dimethylpropoxycarbonyl)-5-methoxyphenyl]boronic acid. InChIKey: GNSKLGLSBOFRQO-UHFFFAOYSA-N.
| Molecular formula | C13H19BO5 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | [2-(2,2-dimethylpropoxycarbonyl)-5-methoxyphenyl]boronic acid |
| InChIKey | GNSKLGLSBOFRQO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C(=O)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)