cas: 201929-84-2 — see every product listed under this CAS number, including other names
Ethyl 5-(trifluoromethyl)indole-2-carboxylate, 97% (CAS 201929-84-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237384-100MG |
| cas | 201929-84-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 4475.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 5-(trifluoromethyl)-1H-indole-2-carboxylate (CAS 201929-84-2) is a chemical compound with the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. IUPAC name: ethyl 5-(trifluoromethyl)-1H-indole-2-carboxylate. InChIKey: XFZOLYIGTWILKO-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO2 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | ethyl 5-(trifluoromethyl)-1H-indole-2-carboxylate |
| InChIKey | XFZOLYIGTWILKO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)