Products 252729-38-7

CAS 252729-38-7 is the registry number for 3,3,3-Trifluoro-2-(5-methyl-1h-indol-3-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3,3,3-trifluoro-2-(5-methyl-1H-indol-3-yl)propanoic acid (CAS 252729-38-7) is a chemical compound with the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. IUPAC name: 3,3,3-trifluoro-2-(5-methyl-1H-indol-3-yl)propanoic acid. InChIKey: LKHIMJBMQONIHF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10F3NO2
Molecular weight257.21 g/mol
IUPAC name3,3,3-trifluoro-2-(5-methyl-1H-indol-3-yl)propanoic acid
InChIKeyLKHIMJBMQONIHF-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)NC=C2C(C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)