cas: 1101120-35-7 — see every product listed under this CAS number, including other names
Ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate, 95%, 95% (CAS 1101120-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U0J-100mg |
| cas | 1101120-35-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 500mg | 381.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1058.00 Pln | |
| Chemat | 10g | 1758.80 Pln | |
| Chemat | 25g | 4058.00 Pln | |
| Chemat | 50g | 5147.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate (CAS 1101120-35-7) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: PEZWWKGGTIYZPN-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | PEZWWKGGTIYZPN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=C(C=CN2N=C1)N |
Computed by PubChem (NCBI)