Products 1182902-09-5
CAS 1182902-09-5 is the registry number for 3-(3-Aminophenyl)-1,3-diazinane-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3-aminophenyl)-1,3-diazinane-2,4-dione (CAS 1182902-09-5) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 3-(3-aminophenyl)-1,3-diazinane-2,4-dione. InChIKey: YQWIPDZKTXWPRL-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 3-(3-aminophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | YQWIPDZKTXWPRL-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)