Ethyl 5-bromo-6-chloropicolinate, 97%
cas: 1214337-57-1 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-6-chloropicolinate, 97% (CAS 1214337-57-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 10g. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QP-1234-1g |
| cas | 1214337-57-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 25g | 1833.31 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 180.16 Pln | |
| Fluorochem | 5g | 430.07 Pln | |
| Fluorochem | 25g | 1882.69 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 453.20 Pln | |
| BLDpharm | 25g | 1969.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Ethyl 5-bromo-6-chloropyridine-2-carboxylate (CAS 1214337-57-1) is a chemical compound with the molecular formula C8H7BrClNO2 and a molecular weight of 264.50 g/mol. IUPAC name: ethyl 5-bromo-6-chloropyridine-2-carboxylate. InChIKey: WTNYDXPIALFUCV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO2 |
|---|---|
| Molecular weight | 264.50 g/mol |
| IUPAC name | ethyl 5-bromo-6-chloropyridine-2-carboxylate |
| InChIKey | WTNYDXPIALFUCV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)