CAS 1214388-02-9 appears in our catalog under these names: Ethyl 2-bromo-6-chloroisonicotinate, 95%, Ethyl 2-bromo-6-chloroisonicotinate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg.
Ethyl 2-bromo-6-chloropyridine-4-carboxylate (CAS 1214388-02-9) is a chemical compound with the molecular formula C8H7BrClNO2 and a molecular weight of 264.50 g/mol. IUPAC name: ethyl 2-bromo-6-chloropyridine-4-carboxylate. InChIKey: UCRWPGSEZFXMRM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO2 |
|---|---|
| Molecular weight | 264.50 g/mol |
| IUPAC name | ethyl 2-bromo-6-chloropyridine-4-carboxylate |
| InChIKey | UCRWPGSEZFXMRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)Br)Cl |
Computed by PubChem (NCBI)