cas: 13771-68-1 — see every product listed under this CAS number, including other names
Ethyl 5-bromobenzo[b]thiophene-2-carboxylate 95% (CAS 13771-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A734385-250mg |
| cas | 13771-68-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 1026.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A734385 |
Ethyl 5-bromo-1-benzothiophene-2-carboxylate (CAS 13771-68-1) is a chemical compound with the molecular formula C11H9BrO2S and a molecular weight of 285.16 g/mol. IUPAC name: ethyl 5-bromo-1-benzothiophene-2-carboxylate. InChIKey: QYNBPINLQQVHBJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2S |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | ethyl 5-bromo-1-benzothiophene-2-carboxylate |
| InChIKey | QYNBPINLQQVHBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C=CC(=C2)Br |
Computed by PubChem (NCBI)