cas: 13771-68-1 — see every product listed under this CAS number, including other names
ethyl 5-bromo-1-benzothiophene-2-carboxylate, 98% (CAS 13771-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F518219-1G |
| cas | 13771-68-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 10g | 1257.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-bromo-1-benzothiophene-2-carboxylate (CAS 13771-68-1) is a chemical compound with the molecular formula C11H9BrO2S and a molecular weight of 285.16 g/mol. IUPAC name: ethyl 5-bromo-1-benzothiophene-2-carboxylate. InChIKey: QYNBPINLQQVHBJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2S |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | ethyl 5-bromo-1-benzothiophene-2-carboxylate |
| InChIKey | QYNBPINLQQVHBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C=CC(=C2)Br |
Computed by PubChem (NCBI)