cas: 105191-13-7 — see every product listed under this CAS number, including other names
Ethyl 5-cyanoindole-2-carboxylate, 97% (CAS 105191-13-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092620-1G |
| cas | 105191-13-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 10g | 1028.82 Pln | |
| Fluorochem | 25g | 2340.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-cyano-1H-indole-2-carboxylate (CAS 105191-13-7) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: ethyl 5-cyano-1H-indole-2-carboxylate. InChIKey: VZSOXWAHGVEQOT-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | ethyl 5-cyano-1H-indole-2-carboxylate |
| InChIKey | VZSOXWAHGVEQOT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C#N |
Computed by PubChem (NCBI)