cas: 1823383-20-5 — see every product listed under this CAS number, including other names
Ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate, 96%, 96% (CAS 1823383-20-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JKEL-100mg |
| cas | 1823383-20-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1734.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate (CAS 1823383-20-5) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: JOFPGKPZJXJHTD-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | ethyl 5-fluoro-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | JOFPGKPZJXJHTD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C1)C=C(C=C2)F |
Computed by PubChem (NCBI)