Ethyl 5-methoxy-2-methylbenzoate, 99+%
cas: 855949-35-8 — see every product listed under this CAS number, including other names
Ethyl 5-methoxy-2-methylbenzoate, 99+% (CAS 855949-35-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1475892-1g |
| cas | 855949-35-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 153.44 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 937.75 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 158.86 Pln | |
| BLDpharm | 25g | 358.79 Pln | |
| BLDpharm | 100g | 1003.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 458.00 Pln | |
| Chemat | 100g | 1278.80 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 25g | 830.98 Pln | |
| Fluorochem | 100g | 2366.89 Pln |
properties
| purity | 99+% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 5-methoxy-2-methylbenzoate (CAS 855949-35-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: ethyl 5-methoxy-2-methylbenzoate. InChIKey: HOAVCIXZWWYJKJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | ethyl 5-methoxy-2-methylbenzoate |
| InChIKey | HOAVCIXZWWYJKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)OC)C |
Computed by PubChem (NCBI)