cas: 52047-16-2 — see every product listed under this CAS number, including other names
Ethyl 5-nitro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate, 98%, 98% (CAS 52047-16-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJII-100mg |
| cas | 52047-16-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 635.60 Pln | |
| Chemat | 250mg | 1019.60 Pln | |
| Chemat | 1g | 1509.20 Pln | |
| Chemat | 5g | 2138.00 Pln | |
| Chemat | 25g | 7422.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate (CAS 52047-16-2) is a chemical compound with the molecular formula C7H7N3O6 and a molecular weight of 229.15 g/mol. IUPAC name: ethyl 5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate. InChIKey: DAZDARINDDLSLS-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O6 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | ethyl 5-nitro-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| InChIKey | DAZDARINDDLSLS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)