CAS 59694-23-4 appears in our catalog under these names: Dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate 97%, Dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate, 98%, 1H-Pyrazole-3,5-dicarboxylic acid, 4-nitro-, 3,5-dimethyl ester, 96%, 1H-Pyrazole-3,5-dicarboxylic acid, 4-nitro-, 3,5-dimethyl ester, 97%, 97%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate (CAS 59694-23-4) is a chemical compound with the molecular formula C7H7N3O6 and a molecular weight of 229.15 g/mol. IUPAC name: dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate. InChIKey: RRANRLASTUBGSJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O6 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate |
| InChIKey | RRANRLASTUBGSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NN1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)