cas: 327-21-9 — see every product listed under this CAS number, including other names
Ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate 96% (CAS 327-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111063-100mg |
| cas | 327-21-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1583.00 Pln | |
| Ambeed | 5g | 5343.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111063 |
Ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate (CAS 327-21-9) is a chemical compound with the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. IUPAC name: ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate. InChIKey: MIBFONNBTQRYGN-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO2 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate |
| InChIKey | MIBFONNBTQRYGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)