Ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate, 96%
cas: 327-21-9 — see every product listed under this CAS number, including other names
Ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate, 96% (CAS 327-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A111063-100mg |
| cas | 327-21-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1538.50 Pln | |
| Ambeed | 5g | 4864.88 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1278.80 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 503.18 Pln | |
| BLDpharm | 1g | 1352.88 Pln | |
| BLDpharm | 5g | 5023.81 Pln | |
| BLDpharm | 10g | 8750.28 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate (CAS 327-21-9) is a chemical compound with the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. IUPAC name: ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate. InChIKey: MIBFONNBTQRYGN-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO2 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | ethyl 6-(trifluoromethyl)-1H-indole-2-carboxylate |
| InChIKey | MIBFONNBTQRYGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)