cas: 1196153-46-4 — see every product listed under this CAS number, including other names
Ethyl 6-Aminoimidazo[1,2-a]pyridine-3-carboxylate, ≥95%, ≥95% (CAS 1196153-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NL2S-100mg |
| cas | 1196153-46-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1965.20 Pln | |
| Chemat | 250mg | 2301.20 Pln | |
| Chemat | 1g | 3851.60 Pln | |
| Chemat | 5g | 8334.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-aminoimidazo[1,2-a]pyridine-3-carboxylate (CAS 1196153-46-4) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 6-aminoimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: SDZGFYJNXUSJFG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 6-aminoimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | SDZGFYJNXUSJFG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N1C=C(C=C2)N |
Computed by PubChem (NCBI)