Products 1020572-61-5
CAS 1020572-61-5 is the registry number for Ethyl 6-Bromoquinoline-2-Carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 6-bromoquinoline-2-carboxylate (CAS 1020572-61-5) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: ethyl 6-bromoquinoline-2-carboxylate. InChIKey: KIKGJVVDJNSJSQ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2 |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | ethyl 6-bromoquinoline-2-carboxylate |
| InChIKey | KIKGJVVDJNSJSQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)