Products 1189106-92-0

CAS 1189106-92-0 is the registry number for 7-Bromo-2,8-dimethylquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

7-bromo-2,8-dimethylquinoline-3-carboxylic acid (CAS 1189106-92-0) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: 7-bromo-2,8-dimethylquinoline-3-carboxylic acid. InChIKey: WLPLPFSWQMZHOT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO2
Molecular weight280.12 g/mol
IUPAC name7-bromo-2,8-dimethylquinoline-3-carboxylic acid
InChIKeyWLPLPFSWQMZHOT-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=CC(=C(N=C12)C)C(=O)O)Br

Computed by PubChem (NCBI)