cas: 13996-05-9 — see every product listed under this CAS number, including other names
Ethyl 6-methyl-2-oxo-4-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate, 95%, 95% (CAS 13996-05-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112BVS-100mg |
| cas | 13996-05-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 1782.80 Pln | |
| Chemat | 10g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-methyl-2-oxo-4-sulfanylidene-1H-pyrimidine-5-carboxylate (CAS 13996-05-9) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: ethyl 6-methyl-2-oxo-4-sulfanylidene-1H-pyrimidine-5-carboxylate. InChIKey: FKWPOCBDNMHKCV-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | ethyl 6-methyl-2-oxo-4-sulfanylidene-1H-pyrimidine-5-carboxylate |
| InChIKey | FKWPOCBDNMHKCV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=O)NC1=S)C |
Computed by PubChem (NCBI)