Products 92819-12-0

CAS 92819-12-0 is the registry number for Ethyl 2-acetamido-1,3-thiazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-acetamido-1,3-thiazole-4-carboxylate (CAS 92819-12-0) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: ethyl 2-acetamido-1,3-thiazole-4-carboxylate. InChIKey: RJJRNCMTKFEYCB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O3S
Molecular weight214.24 g/mol
IUPAC nameethyl 2-acetamido-1,3-thiazole-4-carboxylate
InChIKeyRJJRNCMTKFEYCB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)NC(=O)C

Computed by PubChem (NCBI)