cas: 220844-75-7 — see every product listed under this CAS number, including other names
Ethyl 8-bromoquinoline-4-carboxylate 95% (CAS 220844-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A806829-100mg |
| cas | 220844-75-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 1588.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A806829 |
Ethyl 8-bromoquinoline-4-carboxylate (CAS 220844-75-7) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: ethyl 8-bromoquinoline-4-carboxylate. InChIKey: QAZUDLFASXSZFY-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2 |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | ethyl 8-bromoquinoline-4-carboxylate |
| InChIKey | QAZUDLFASXSZFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=CC=C(C2=NC=C1)Br |
Computed by PubChem (NCBI)