cas: 2288709-10-2 — see every product listed under this CAS number, including other names
Ethyl N-(3-bromo-2-nitrophenyl)-N-(methylsulfonyl)glycinate 90% (CAS 2288709-10-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1379439-100mg |
| cas | 2288709-10-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1633.06 Pln |
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1379439 |
Ethyl 2-(3-bromo-N-methylsulfonyl-2-nitroanilino)acetate (CAS 2288709-10-2) is a chemical compound with the molecular formula C11H13BrN2O6S and a molecular weight of 381.20 g/mol. IUPAC name: ethyl 2-(3-bromo-N-methylsulfonyl-2-nitroanilino)acetate. InChIKey: MLRJWFLSZBGNIM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O6S |
|---|---|
| Molecular weight | 381.20 g/mol |
| IUPAC name | ethyl 2-(3-bromo-N-methylsulfonyl-2-nitroanilino)acetate |
| InChIKey | MLRJWFLSZBGNIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C1=C(C(=CC=C1)Br)[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)