Ethyl diethoxyacetate, 97%
cas: 6065-82-3 — see every product listed under this CAS number, including other names
Ethyl diethoxyacetate, 97% (CAS 6065-82-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 50g. Offered by: Ambeed, BLDpharm, Sigma-Aldrich, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A227247-1g |
| cas | 6065-82-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 225.75 Pln | |
| Ambeed | 500g | 787.56 Pln | |
| Ambeed | 1kg | 1349.38 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 236.61 Pln | |
| BLDpharm | 500g | 775.31 Pln | |
| BLDpharm | 1kg | 1325.11 Pln | |
| Sigma-Aldrich | 100G | 1070.00 Pln | |
| Fluorochem | 10g | 102.06 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 50g | 143.72 Pln | |
| Fluorochem | 100g | 200.99 Pln | |
| Fluorochem | 500g | 653.95 Pln | |
| Fluorochem | 1kg | 1164.19 Pln | |
| Fluorochem | 5g | 102.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2,2-diethoxyacetate (CAS 6065-82-3) is a chemical compound with the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. IUPAC name: ethyl 2,2-diethoxyacetate. InChIKey: XCLBIKIQSCTANZ-UHFFFAOYSA-N.
| Molecular formula | C8H16O4 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | ethyl 2,2-diethoxyacetate |
| InChIKey | XCLBIKIQSCTANZ-UHFFFAOYSA-N |
| SMILES | CCOC(C(=O)OCC)OCC |
Computed by PubChem (NCBI)
Synonyms:
Ethyl diethoxyacetate, Acetic acid, diethoxy-, ethyl ester, Diethoxyacetic acid ethyl ester, ACETIC ACID,DIETHOXY,ETHYL ESTER, Acetic acid, 2,2-diethoxy-, ethyl ester, InChI=1/C8H16O4/c1-4-10-7(9)8(11-5-2)12-6-3/h8H,4-6H2,1-3H, XCLBIKIQSCTANZ-UHFFFAOYSA-N, ethyl 2,2-diethoxyacetate, Glyoxylic acid ethyl ester diethyl acetal, Ethyl Glyoxylate Diethyl Acetal