CAS 470-12-2 is the registry number for Cladinose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
(3S,4R,5R)-4,5-dihydroxy-3-methoxy-3-methylhexanal (CAS 470-12-2) is a chemical compound with the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. IUPAC name: (3S,4R,5R)-4,5-dihydroxy-3-methoxy-3-methylhexanal. InChIKey: AJSDVNKVGFVAQU-PRJMDXOYSA-N.
| Molecular formula | C8H16O4 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (3S,4R,5R)-4,5-dihydroxy-3-methoxy-3-methylhexanal |
| InChIKey | AJSDVNKVGFVAQU-PRJMDXOYSA-N |
| SMILES | C[C@H]([C@H]([C@](C)(CC=O)OC)O)O |
Computed by PubChem (NCBI)