cas: 4046-02-0 — see every product listed under this CAS number, including other names
Ethyl ferulate 98% (E,HPLC) (CAS 4046-02-0) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 100mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172065-1000g |
| cas | 4046-02-0 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2250.50 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 431.56 Pln | |
| Ambeed | 500g | 1427.25 Pln |
| purity | 98% (E,HPLC) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A172065 |
Ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 4046-02-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: ATJVZXXHKSYELS-FNORWQNLSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | ATJVZXXHKSYELS-FNORWQNLSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C=C1)O)OC |
Computed by PubChem (NCBI)