CAS 628-96-6 appears in our catalog under these names: Ethyleneglycoldinitrate 100 µg/mL in Acetonitrile, EGDN, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1ml, 1x1ml.
2-nitrooxyethyl nitrate (CAS 628-96-6) is a chemical compound with the molecular formula C2H4N2O6 and a molecular weight of 152.06 g/mol. IUPAC name: 2-nitrooxyethyl nitrate. InChIKey: UQXKXGWGFRWILX-UHFFFAOYSA-N.
| Molecular formula | C2H4N2O6 |
|---|---|
| Molecular weight | 152.06 g/mol |
| IUPAC name | 2-nitrooxyethyl nitrate |
| InChIKey | UQXKXGWGFRWILX-UHFFFAOYSA-N |
| SMILES | C(CO[N+](=O)[O-])O[N+](=O)[O-] |
Computed by PubChem (NCBI)