Products 83-75-0
CAS 83-75-0 appears in our catalog under these names: Euquinine/ 99.35% (existing batch purity), Euquinine, Euquinine, 97%, 97%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 200mg, 5mg, 10mg, 100 mg, 10 mg, 50 mg.
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] ethyl carbonate (CAS 83-75-0) is a chemical compound with the molecular formula C23H28N2O4 and a molecular weight of 396.5 g/mol. IUPAC name: [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] ethyl carbonate. InChIKey: NSBRKSWSLRQPJW-WWLNLUSPSA-N.
| Molecular formula | C23H28N2O4 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] ethyl carbonate |
| InChIKey | NSBRKSWSLRQPJW-WWLNLUSPSA-N |
| SMILES | CCOC(=O)O[C@@H]([C@@H]1C[C@@H]2CCN1C[C@@H]2C=C)C3=C4C=C(C=CC4=NC=C3)OC |
Computed by PubChem (NCBI)