CAS 945531-77-1 appears in our catalog under these names: Ezutromid/ 98.47% (existing batch purity), Ezutromid, 5-(Ethylsulfonyl)-2-(2-naphthalenyl)benzoxazole, 98%, 98%, Ezutromid, 98.94%, Ezutromid (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
5-ethylsulfonyl-2-naphthalen-2-yl-1,3-benzoxazole (CAS 945531-77-1) is a chemical compound with the molecular formula C19H15NO3S and a molecular weight of 337.4 g/mol. IUPAC name: 5-ethylsulfonyl-2-naphthalen-2-yl-1,3-benzoxazole. InChIKey: KSGCNXAZROJSNW-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 5-ethylsulfonyl-2-naphthalen-2-yl-1,3-benzoxazole |
| InChIKey | KSGCNXAZROJSNW-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC2=C(C=C1)OC(=N2)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)