Products 888009-05-0

CAS 888009-05-0 is the registry number for 10-(4-Methoxyphenyl)-10H-phenothiazine 5,5-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

10-(4-methoxyphenyl)phenothiazine 5,5-dioxide (CAS 888009-05-0) is a chemical compound with the molecular formula C19H15NO3S and a molecular weight of 337.4 g/mol. IUPAC name: 10-(4-methoxyphenyl)phenothiazine 5,5-dioxide. InChIKey: GETNKPADDLOLAP-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO3S
Molecular weight337.4 g/mol
IUPAC name10-(4-methoxyphenyl)phenothiazine 5,5-dioxide
InChIKeyGETNKPADDLOLAP-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N2C3=CC=CC=C3S(=O)(=O)C4=CC=CC=C42

Computed by PubChem (NCBI)