CAS 888009-05-0 is the registry number for 10-(4-Methoxyphenyl)-10H-phenothiazine 5,5-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
10-(4-methoxyphenyl)phenothiazine 5,5-dioxide (CAS 888009-05-0) is a chemical compound with the molecular formula C19H15NO3S and a molecular weight of 337.4 g/mol. IUPAC name: 10-(4-methoxyphenyl)phenothiazine 5,5-dioxide. InChIKey: GETNKPADDLOLAP-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 10-(4-methoxyphenyl)phenothiazine 5,5-dioxide |
| InChIKey | GETNKPADDLOLAP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=CC=CC=C3S(=O)(=O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)