CAS 1010096-65-7 appears in our catalog under these names: AM6701, LY2183240 2'–isomer, LY2183240 2’-isomer, 99%, 99%, FAAH/MAGL-IN-5, 94.16%, 5-([1,1'-Biphenyl]-4-ylmethyl)-N,N-dimethyl-2H-tetrazole-2-carboxamide, 99%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 5 mg, 25 mg, 50 mg, 1 mg.
N,N-dimethyl-5-[(4-phenylphenyl)methyl]tetrazole-2-carboxamide (CAS 1010096-65-7) is a chemical compound with the molecular formula C17H17N5O and a molecular weight of 307.35 g/mol. IUPAC name: N,N-dimethyl-5-[(4-phenylphenyl)methyl]tetrazole-2-carboxamide. InChIKey: VBVLSXPOMAONNK-UHFFFAOYSA-N.
| Molecular formula | C17H17N5O |
|---|---|
| Molecular weight | 307.35 g/mol |
| IUPAC name | N,N-dimethyl-5-[(4-phenylphenyl)methyl]tetrazole-2-carboxamide |
| InChIKey | VBVLSXPOMAONNK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N1N=C(N=N1)CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)