CAS 1211825-25-0 appears in our catalog under these names: ZINC40099027, 98%, FAK activator 1/ 98.85% (existing batch purity), ZINC40099027, 2-(4-Methoxyphenyl)-N-[2-(4-morpholinyl)-5-(trifluoromethyl)phenyl]-1-pyrrolidinecarboxamide, 99%, 99%, ZINC40099027, 99.97%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
2-(4-methoxyphenyl)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide (CAS 1211825-25-0) is a chemical compound with the molecular formula C23H26F3N3O3 and a molecular weight of 449.5 g/mol. IUPAC name: 2-(4-methoxyphenyl)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide. InChIKey: MOEURIVQRFKTCR-UHFFFAOYSA-N.
| Molecular formula | C23H26F3N3O3 |
|---|---|
| Molecular weight | 449.5 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
| InChIKey | MOEURIVQRFKTCR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCCN2C(=O)NC3=C(C=CC(=C3)C(F)(F)F)N4CCOCC4 |
Computed by PubChem (NCBI)