cas: 2307461-45-4 — see every product listed under this CAS number, including other names
FAK ligand-Linker Conjugate 1, 98% (CAS 2307461-45-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1216723-5mg |
| cas | 2307461-45-4 |
| size | 5mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5mg | 9939.16 Pln | |
| AmBeed | 1mg | 5603.50 Pln | |
| Fluorochem | 1mg | 3074.98 Pln | |
| Fluorochem | 5mg | 5381.46 Pln | |
| Fluorochem | 10mg | 8041.98 Pln | |
| Ambeed | 10mg | 548.38 Pln | |
| Ambeed | 25mg | 971.12 Pln | |
| Ambeed | 50mg | 1594.12 Pln | |
| Ambeed | 250mg | 5543.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[2-[4-[[4-[[3-[methyl(methylsulfonyl)amino]phenyl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]ethoxy]propanoic acid (CAS 2307461-45-4) is a chemical compound with the molecular formula C25H28F3N5O6S and a molecular weight of 583.6 g/mol. IUPAC name: 3-[2-[4-[[4-[[3-[methyl(methylsulfonyl)amino]phenyl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]ethoxy]propanoic acid. InChIKey: OSVHAJNGZCDBGV-UHFFFAOYSA-N.
| Molecular formula | C25H28F3N5O6S |
|---|---|
| Molecular weight | 583.6 g/mol |
| IUPAC name | 3-[2-[4-[[4-[[3-[methyl(methylsulfonyl)amino]phenyl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]ethoxy]propanoic acid |
| InChIKey | OSVHAJNGZCDBGV-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC(=C1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC=C(C=C3)OCCOCCC(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)