CAS 2307461-45-4 appears in our catalog under these names: FAK ligand-Linker Conjugate 1, 98%, FAK ligand–Linker Conjugate 1, Fak ligand-linker conjugate 1, FAK ligand-Linker Conjugate 1 98%, FAK ligand-Linker Conjugate 1, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10mM/1mL.
3-[2-[4-[[4-[[3-[methyl(methylsulfonyl)amino]phenyl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]ethoxy]propanoic acid (CAS 2307461-45-4) is a chemical compound with the molecular formula C25H28F3N5O6S and a molecular weight of 583.6 g/mol. IUPAC name: 3-[2-[4-[[4-[[3-[methyl(methylsulfonyl)amino]phenyl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]ethoxy]propanoic acid. InChIKey: OSVHAJNGZCDBGV-UHFFFAOYSA-N.
| Molecular formula | C25H28F3N5O6S |
|---|---|
| Molecular weight | 583.6 g/mol |
| IUPAC name | 3-[2-[4-[[4-[[3-[methyl(methylsulfonyl)amino]phenyl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]ethoxy]propanoic acid |
| InChIKey | OSVHAJNGZCDBGV-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC(=C1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC=C(C=C3)OCCOCCC(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)