CAS 491839-65-7 appears in our catalog under these names: FAK-IN-10/ 99.78% (existing batch purity), FAK–IN–10, 1-(4-Bromophenyl)-2-((5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)thio)ethan-1-one, 98%, 98%, FAK-IN-10, 98.04%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
1-(4-bromophenyl)-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanone (CAS 491839-65-7) is a chemical compound with the molecular formula C15H10BrN3O2S and a molecular weight of 376.2 g/mol. IUPAC name: 1-(4-bromophenyl)-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanone. InChIKey: RZRDLDDOZNGXJT-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3O2S |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanone |
| InChIKey | RZRDLDDOZNGXJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CSC2=NN=C(O2)C3=CC=NC=C3)Br |
Computed by PubChem (NCBI)