CAS 2243736-45-8 appears in our catalog under these names: Fb23-2, 95%, FB23-2/ 98.91% (existing batch purity), FB23-2 98%, 2-((2,6-Dichloro-4-(3,5-dimethylisoxazol-4-yl)phenyl)amino)-N-hydroxybenzamide, 98%, 98%, FB23-2, 99.93%. Offered by: Combi-blocks, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 250mg.
2-[2,6-dichloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]-N-hydroxybenzamide (CAS 2243736-45-8) is a chemical compound with the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.2 g/mol. IUPAC name: 2-[2,6-dichloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]-N-hydroxybenzamide. InChIKey: ILHNIWOZZKIBNW-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl2N3O3 |
|---|---|
| Molecular weight | 392.2 g/mol |
| IUPAC name | 2-[2,6-dichloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]-N-hydroxybenzamide |
| InChIKey | ILHNIWOZZKIBNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=C(C(=C2)Cl)NC3=CC=CC=C3C(=O)NO)Cl |
Computed by PubChem (NCBI)