CAS 824983-94-0 appears in our catalog under these names: FEN1-IN-2/ 98.96% (existing batch purity), FEN1–IN–2, 3'-((3-Hydroxy-2,4-dioxo-3,4-dihydrothieno[3,2-d]pyrimidin-1(2H)-yl)methyl)-[1,1'-biphenyl]-4-carboxamide, 98%, 98%, FEN1-IN-2, 99.94%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
4-[3-[(3-hydroxy-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)methyl]phenyl]benzamide (CAS 824983-94-0) is a chemical compound with the molecular formula C20H15N3O4S and a molecular weight of 393.4 g/mol. IUPAC name: 4-[3-[(3-hydroxy-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)methyl]phenyl]benzamide. InChIKey: VQEJSOSSYFEKGH-UHFFFAOYSA-N.
| Molecular formula | C20H15N3O4S |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 4-[3-[(3-hydroxy-2,4-dioxothieno[3,2-d]pyrimidin-1-yl)methyl]phenyl]benzamide |
| InChIKey | VQEJSOSSYFEKGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)C(=O)N)CN3C4=C(C(=O)N(C3=O)O)SC=C4 |
Computed by PubChem (NCBI)