CAS 1391934-98-7 appears in our catalog under these names: FIDAS-5/ 98.3% (existing batch purity), FIDAS–5, FIDAS-5 97%, (E)-4-(2-Chloro-6-fluorostyryl)-N-methylaniline, 97%, 97%, FIDAS-5, 98.46%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N-methylaniline (CAS 1391934-98-7) is a chemical compound with the molecular formula C15H13ClFN and a molecular weight of 261.72 g/mol. IUPAC name: 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N-methylaniline. InChIKey: KXVXICBOMOGFMH-JXMROGBWSA-N.
| Molecular formula | C15H13ClFN |
|---|---|
| Molecular weight | 261.72 g/mol |
| IUPAC name | 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N-methylaniline |
| InChIKey | KXVXICBOMOGFMH-JXMROGBWSA-N |
| SMILES | CNC1=CC=C(C=C1)/C=C/C2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)