CAS 1113044-49-7 appears in our catalog under these names: FIT-039, 97%, FIT-039/ 100%, FIT–039, FIT-039, FIT-039, 98.61% ,, 98.61% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-(5-fluoro-2-piperidin-1-ylphenyl)pyridine-4-carbothioamide (CAS 1113044-49-7) is a chemical compound with the molecular formula C17H18FN3S and a molecular weight of 315.4 g/mol. IUPAC name: N-(5-fluoro-2-piperidin-1-ylphenyl)pyridine-4-carbothioamide. InChIKey: VRKZHYSJZOUICG-UHFFFAOYSA-N.
| Molecular formula | C17H18FN3S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | N-(5-fluoro-2-piperidin-1-ylphenyl)pyridine-4-carbothioamide |
| InChIKey | VRKZHYSJZOUICG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)F)NC(=S)C3=CC=NC=C3 |
Computed by PubChem (NCBI)