CAS 885672-81-1 appears in our catalog under these names: FL104/ 99.46% (existing batch purity), FL104, 95%, 95%, FL104. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-4-phenylbenzamide (CAS 885672-81-1) is a chemical compound with the molecular formula C24H25ClN2O and a molecular weight of 392.9 g/mol. IUPAC name: N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-4-phenylbenzamide. InChIKey: JXJCJZNVWYQHIF-UHFFFAOYSA-N.
| Molecular formula | C24H25ClN2O |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | N-[1-(4-chlorophenyl)-3-(dimethylamino)propyl]-4-phenylbenzamide |
| InChIKey | JXJCJZNVWYQHIF-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(C1=CC=C(C=C1)Cl)NC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)