Products 1481401-71-1
CAS 1481401-71-1 appears in our catalog under these names: FLTX1, FLTX1/ 98.46% (existing batch purity), FLTX1, ≥98%, ≥98%, FLTX1, 99.75%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, 100mg, 10mM/1mL, 100 mg.
N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine (CAS 1481401-71-1) is a chemical compound with the molecular formula C31H28N4O4 and a molecular weight of 520.6 g/mol. IUPAC name: N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine. InChIKey: UKSXWLGSDIHAEK-WCTVFOPTSA-N.
| Molecular formula | C31H28N4O4 |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChIKey | UKSXWLGSDIHAEK-WCTVFOPTSA-N |
| SMILES | CC/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCN(C)C3=CC=C(C4=NON=C34)[N+](=O)[O-])/C5=CC=CC=C5 |
Computed by PubChem (NCBI)