CAS 162112-35-8 appears in our catalog under these names: N-(3-Triethylammoniopropyl)-4-(6-(4-(diethylamino)phenyl) hexatrienyl)pyridinium dibromide, FM4-64/ 99.41% (existing batch purity), SynaptoRedTM C2, FM4-64 95%, SynaptoRedΓäó Reagent 1PC X 5MG. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50 μL, 100 μL, 5 mg.
3-[4-[(1E,3E,5E)-6-[4-(diethylamino)phenyl]hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide (CAS 162112-35-8) is a chemical compound with the molecular formula C30H45Br2N3 and a molecular weight of 607.5 g/mol. IUPAC name: 3-[4-[(1E,3E,5E)-6-[4-(diethylamino)phenyl]hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide. InChIKey: AFVSZGYRRUMOFH-UHFFFAOYSA-L.
| Molecular formula | C30H45Br2N3 |
|---|---|
| Molecular weight | 607.5 g/mol |
| IUPAC name | 3-[4-[(1E,3E,5E)-6-[4-(diethylamino)phenyl]hexa-1,3,5-trienyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
| InChIKey | AFVSZGYRRUMOFH-UHFFFAOYSA-L |
| SMILES | CCN(CC)C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=[N+](C=C2)CCC[N+](CC)(CC)CC.[Br-].[Br-] |
Computed by PubChem (NCBI)