cas: 69256-17-3 — see every product listed under this CAS number, including other names
FMAU 98% (CAS 69256-17-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170694-25mg |
| cas | 69256-17-3 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 142.31 Pln | |
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 2200.44 Pln | |
| Ambeed | 10g | 3657.81 Pln | |
| Ambeed | 25g | 7829.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170694 |
1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 69256-17-3) is a chemical compound with the molecular formula C10H13FN2O5 and a molecular weight of 260.22 g/mol. IUPAC name: 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: GBBJCSTXCAQSSJ-JVZYCSMKSA-N.
| Molecular formula | C10H13FN2O5 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | GBBJCSTXCAQSSJ-JVZYCSMKSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)F |
Computed by PubChem (NCBI)