CAS 863329-66-2 appears in our catalog under these names: (2'R)-2'-Deoxy-2'-fluoro-2'-methyluridine, 97%, 97%, Sofosbuvir Nucleoside Derivative (GS-331007), RO 2433, >95% (HPLC), PSI-6206/ 99.33% (existing batch purity), PSI–6206. Offered by: Chemat, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 50mg, on request, 250mg.
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione (CAS 863329-66-2) is a chemical compound with the molecular formula C10H13FN2O5 and a molecular weight of 260.22 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione. InChIKey: ARKKGZQTGXJVKW-VPCXQMTMSA-N.
| Molecular formula | C10H13FN2O5 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | ARKKGZQTGXJVKW-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O)F |
Computed by PubChem (NCBI)