cas: 914399-98-7 — see every product listed under this CAS number, including other names
FMoc-α-Me-Ser(tBu)-OH, 98%, 98% (CAS 914399-98-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H4AH-50mg |
| cas | 914399-98-7 |
| size | 50mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 112.40 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3923.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 914399-98-7) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: WRDFKKLMQLSBQN-QHCPKHFHSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | WRDFKKLMQLSBQN-QHCPKHFHSA-N |
| SMILES | C[C@](COC(C)(C)C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)